{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "2bbce751-0733-48ba-86ea-813b43299087", "code": "136623-01-3", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=136623-01-3", "code_system": "CAS", "references": [ "1de56b4f-bda6-4dcd-88e3-4367791aac6e", "5f5049aa-c967-444b-9980-df67d270bb1f" ] }, { "uuid": "606a7630-c123-4aec-98d1-59a24cb391eb", "code": "NS102", "type": "PRIMARY", "url": "https://en.wikipedia.org/wiki/NS102", "code_system": "WIKIPEDIA", "references": [ "1de56b4f-bda6-4dcd-88e3-4367791aac6e" ] }, { "uuid": "c56b59aa-84e1-4ecf-a2f8-f7f5087a0cd1", "code": "5282252", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/5282252", "code_system": "PUBCHEM", "references": [ "1de56b4f-bda6-4dcd-88e3-4367791aac6e" ] }, { "uuid": "cbf55d1a-afb8-7a72-0d94-4e1c43fa6edf", "code": "DTXSID30159858", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID30159858", "code_system": "EPA CompTox", "references": [ "4aeca88d-f2b5-29c8-ec71-d188336b46f8" ] }, { "uuid": "9dbe4206-e121-4ced-9b3c-5f2e00712a21", "code": "00978E5H3R", "type": "PRIMARY", "code_system": "FDA UNII" } ], "substance_class": "chemical", "names": [ { "uuid": "32a19e99-528c-4a75-afbb-e324e9106a8e", "name": "5-NITRO-6,7,8,9-TETRAHYDRO-1H-BENZO(G)INDOLE-2,3-DIONE 3-OXIME", "stdName": "5-NITRO-6,7,8,9-TETRAHYDRO-1H-BENZO(G)INDOLE-2,3-DIONE 3-OXIME", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "10cd0aa1-acc6-43f0-b27b-5235f4e97b7e" ], "display_name": false }, { "uuid": "86af2486-bba9-47fe-9ae1-735cfa4b82bf", "name": "NS-102", "stdName": "NS-102", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "10cd0aa1-acc6-43f0-b27b-5235f4e97b7e" ], "display_name": true }, { "uuid": "813b8e2f-3540-4f0e-8107-375fa0fa8b0b", "name": "NS102", "stdName": "NS102", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "10cd0aa1-acc6-43f0-b27b-5235f4e97b7e" ], "display_name": false }, { "uuid": "9cdb13ae-499f-4163-a48e-ed24ee7d165c", "name": "PD-139977", "stdName": "PD-139977", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "831cf800-7d3c-48ed-ba17-c37c9e604562" ], "display_name": false } ], "references": [ { "uuid": "10cd0aa1-acc6-43f0-b27b-5235f4e97b7e", "citation": "http://en.wikipedia.org/wiki/NS102", "url": "http://en.wikipedia.org/wiki/NS102", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "831cf800-7d3c-48ed-ba17-c37c9e604562", "citation": "stn", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "1de56b4f-bda6-4dcd-88e3-4367791aac6e", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493390778000, "tags": [ "NOMEN" ] }, { "uuid": "0bd44858-9532-48b7-8d0d-d8f8eac3645d", "citation": "SRS import [00978E5H3R]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=00978E5H3R", "doc_type": "SRS", "public_domain": true, "document_date": 1493390778000, "tags": [ "NOMEN" ] }, { "uuid": "4aeca88d-f2b5-29c8-ec71-d188336b46f8", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=136623-01-3", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "5f5049aa-c967-444b-9980-df67d270bb1f", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "468e5844-4583-42ea-bcfb-71b5c177fd1b", "id": "468e5844-4583-42ea-bcfb-71b5c177fd1b", "molfile": "\n Marvin 01132103422D \n\n 19 21 0 0 0 0 999 V2000\n 2.3681 -1.0856 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.7809 -1.7999 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5955 -1.8852 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 3.7660 -2.6861 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.4841 -3.0934 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.1972 -2.6794 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.9128 -3.0968 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.9108 -3.9237 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.1932 -4.3330 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.4820 -3.9202 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.7691 -4.3368 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.0562 -3.9225 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.0570 -3.0959 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4458 -2.5479 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.6209 -2.5479 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 1.2098 -1.8336 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.7702 -5.1617 0.0000 N 0 3 0 0 0 0 0 0 0 0 0 0\n 3.0562 -5.5752 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 4.4851 -5.5733 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 2 1 0 0 0 0\n 2 14 2 0 0 0 0\n 4 3 1 0 0 0 0\n 5 4 1 0 0 0 0\n 13 4 2 0 0 0 0\n 5 6 1 0 0 0 0\n 5 10 2 0 0 0 0\n 7 6 1 0 0 0 0\n 8 7 1 0 0 0 0\n 9 8 1 0 0 0 0\n 10 9 1 0 0 0 0\n 11 10 1 0 0 0 0\n 12 11 2 0 0 0 0\n 11 17 1 0 0 0 0\n 13 12 1 0 0 0 0\n 14 13 1 0 0 0 0\n 14 15 1 0 0 0 0\n 15 16 2 0 0 0 0\n 17 18 1 0 0 0 0\n 17 19 2 0 0 0 0\nM CHG 2 17 1 18 -1\nM END", "smiles": "C1CCc2c(C1)c(cc3c2[nH]c(c3N=O)O)[N+](=O)[O-]", "formula": "C12H11N3O4", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "67392251-be99-4224-87fe-34f077e97400" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "261.2339", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "027de66d-43c5-448d-8d6e-28c6e7f105d1", "version": "3", "structure": { "id": "c490d79e-511d-4326-8e69-f1ab1568ed35", "molfile": "\n Marvin 01132110102D \n\n 19 21 0 0 0 0 999 V2000\n 2.4458 -2.5479 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.6209 -2.5479 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 1.2098 -1.8336 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.0562 -3.9225 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.7691 -4.3368 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.4841 -3.0934 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.4820 -3.9202 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.1932 -4.3330 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.9108 -3.9237 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.9128 -3.0968 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.1972 -2.6794 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.0570 -3.0959 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.7660 -2.6861 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5955 -1.8852 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2.7809 -1.7999 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.7702 -5.1617 0.0000 N 0 3 0 0 0 0 0 0 0 0 0 0\n 3.0562 -5.5752 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.4851 -5.5733 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 2.3681 -1.0856 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6 11 1 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 1 0 0 0 0\n 9 10 1 0 0 0 0\n 10 11 1 0 0 0 0\n 12 13 1 0 0 0 0\n 12 4 2 0 0 0 0\n 4 5 1 0 0 0 0\n 5 7 2 0 0 0 0\n 6 13 2 0 0 0 0\n 13 14 1 0 0 0 0\n 14 15 1 0 0 0 0\n 15 1 1 0 0 0 0\n 1 12 1 0 0 0 0\n 1 2 2 0 0 0 0\n 5 16 1 0 0 0 0\n 16 17 2 0 0 0 0\n 2 3 1 0 0 0 0\n 16 18 1 0 0 0 0\n 6 7 1 0 0 0 0\n 15 19 2 0 0 0 0\nM CHG 2 16 1 18 -1\nM END", "smiles": "C1CCc2c(C1)c(cc/3c2NC(=O)\\C3=N/O)[N+](=O)[O-]", "formula": "C12H11N3O4", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 1, "molecular_weight": "261.2339", "optical_activity": "NONE", "references": [ "0bd44858-9532-48b7-8d0d-d8f8eac3645d", "831cf800-7d3c-48ed-ba17-c37c9e604562" ], "stereo_centers": 0 }, "unii": "00978E5H3R" } ] }