{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "52b52382-704e-a1f9-ecab-e46789b66a1e", "code": "2001", "type": "PRIMARY", "url": "https://www.fao.org/food/food-safety-quality/scientific-advice/jecfa/jecfa-flav/details/en/c/2001/", "code_system": "JECFA MONOGRAPH", "references": [ "68e7d612-3721-26f0-bd7a-734f34d59592" ] }, { "uuid": "02a00152-a057-4645-8df8-792299cb57d8", "code": "MAGNOLOL", "comments": "JECFA|FUNCTIONAL CLASSIFICATION|Flavouring Agent", "type": "PRIMARY", "url": "http://apps.who.int/food-additives-contaminants-jecfa-database/chemical.aspx?chemID=6028", "code_system": "JECFA EVALUATION", "references": [ "27f4b6e1-eed7-4e5f-be04-8e7d8d26320b" ] }, { "uuid": "8eac9d21-8f71-423a-8d13-4ab16b04bd90", "code": "528-43-8", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=528-43-8", "code_system": "CAS", "references": [ "27f4b6e1-eed7-4e5f-be04-8e7d8d26320b", "dbb40d0c-bcee-4589-9be8-5bf63b6ff85a" ] }, { "uuid": "66a4b410-4626-408e-bd43-095125cd7837", "code": "C005498", "type": "PRIMARY", "url": "http://www.ncbi.nlm.nih.gov/mesh/67005498", "code_system": "MESH", "references": [ "27f4b6e1-eed7-4e5f-be04-8e7d8d26320b" ] }, { "uuid": "fcfb1bda-45f4-4088-b5df-4474b4330718", "code": "MAGNOLOL", "type": "PRIMARY", "url": "https://en.wikipedia.org/wiki/Magnolol", "code_system": "WIKIPEDIA", "references": [ "27f4b6e1-eed7-4e5f-be04-8e7d8d26320b" ] }, { "uuid": "1b8d180a-73e6-49dc-b0e9-9ae8d789ccf5", "code": "m7031", "comments": "Merck Index", "type": "PRIMARY", "url": "https://merckindex.rsc.org/monographs/m7031?q=authorize", "code_system": "MERCK INDEX", "references": [ "27f4b6e1-eed7-4e5f-be04-8e7d8d26320b" ] }, { "uuid": "9d012493-5c2e-41d4-bcf1-a9fa5bfa0c3e", "code": "72300", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/72300", "code_system": "PUBCHEM", "references": [ "27f4b6e1-eed7-4e5f-be04-8e7d8d26320b" ] }, { "uuid": "9af340bc-b320-1304-e94e-84d068ba8f12", "code": "7686", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/7686", "code_system": "HSDB", "references": [ "00254969-3de7-d6db-9256-7ca2cf20bf19" ] }, { "uuid": "aafc834b-8a05-a5f3-5633-3ad44bd038cc", "code": "DTXSID0044076", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID0044076", "code_system": "EPA CompTox", "references": [ "64bb8dc7-639d-becd-c12d-4abf9fb1df12" ] }, { "uuid": "c9b07554-477f-48e2-bfb1-04342ddef668", "code": "001E35HGVF", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "336e7415-c0f8-e3de-3fd9-1c7a3a457de8", "code": "2562549", "type": "PRIMARY", "url": "https://rxnav.nlm.nih.gov/REST/rxcui/2562549/allProperties.xml?prop=all", "code_system": "RXCUI", "references": [ "91efd45f-0cae-9a44-f9cc-f6e946547978" ] }, { "uuid": "6940acb0-8cc6-a3d9-4b09-03457d2fb59f", "code": "100000176429", "type": "PRIMARY", "code_system": "SMS_ID", "references": [ "efacc025-289c-b036-7a81-9e049de65deb" ] }, { "uuid": "2c5e7686-664b-8c4a-b3bf-1e189413509a", "code": "001E35HGVF", "type": "PRIMARY", "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=001E35HGVF", "code_system": "DAILYMED", "references": [ "1a8b2d17-c2fb-7f62-8ebc-c04fceef53f7" ] }, { "uuid": "d8f0e6b3-76cc-7105-2d05-e62ac54027e4", "code": "293099", "type": "PRIMARY", "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=293099", "code_system": "NSC", "references": [ "51cbdabf-2c4e-8a1e-0ed9-c9efe6c40dd0" ] } ], "substance_class": "chemical", "references": [ { "uuid": "c087c479-1b28-489a-99f1-6a70bf8b9427", "citation": "ICSAS BATCH 2010", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "a2357d93-5f17-4a16-8e8c-f565e11a3bca", "citation": "MERCK INDEX", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "857c9bfd-432e-426d-831c-0481a38b6e53", "citation": "MERCK INDEX", "doc_type": "MERCK INDEX", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "f5bbac6d-d9a3-454f-aa17-5a2454bfd324", "citation": "Merck", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "e736fe82-c3d8-415f-ac98-1e6d8ebc7989", "citation": "ChemID", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "1e8afcd7-6a9d-43a8-998f-4a438a59db8e", "citation": "http://www.ift.org/knowledge-center/focus-areas/product-development-and-ingredient-innovations/~/med", "url": "http://www.ift.org/knowledge-center/focus-areas/product-development-and-ingredient-innovations/~/med", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "fe6a4979-9249-4695-a4e1-be5257db1c18", "citation": "HSDB", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "8834fd21-758b-4d36-a0c8-7e65f2084f4d", "citation": "PCPC", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "27f4b6e1-eed7-4e5f-be04-8e7d8d26320b", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493390937000, "tags": [ "NOMEN" ] }, { "uuid": "fbb992ed-3751-45b8-bad4-7a32df01ab88", "citation": "SRS import [001E35HGVF]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=001E35HGVF", "doc_type": "SRS", "public_domain": true, "document_date": 1493390937000, "tags": [ "NOMEN" ] }, { "uuid": "06275441-9c69-4612-9a8f-fd661c434744", "citation": "CHEMID 2010", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "6744fee6-5bfb-403a-9955-d722d2ae1b91", "citation": "MAGNOLOL [MI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "1a014d43-fea6-44ca-8213-d9b058bcb747", "citation": "MAGNOLOL [HSDB]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "f2c3e1b6-e282-40f3-b174-f655b6f60a32", "citation": "MAGNOLOL [INCI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "00254969-3de7-d6db-9256-7ca2cf20bf19", "citation": "WEBSITE", "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+528-43-8", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "64bb8dc7-639d-becd-c12d-4abf9fb1df12", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=528-43-8", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "efacc025-289c-b036-7a81-9e049de65deb", "citation": "EU-SRS", "doc_type": "EMA LIST", "public_domain": true }, { "uuid": "91efd45f-0cae-9a44-f9cc-f6e946547978", "citation": "RXNORM", "doc_type": "NLM", "public_domain": true }, { "uuid": "dbb40d0c-bcee-4589-9be8-5bf63b6ff85a", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "51cbdabf-2c4e-8a1e-0ed9-c9efe6c40dd0", "citation": "NCI", "doc_type": "NCI DRUG DICTIONARY", "public_domain": true }, { "uuid": "1a8b2d17-c2fb-7f62-8ebc-c04fceef53f7", "citation": "DailyMed", "doc_type": "DAILYMED", "public_domain": true }, { "uuid": "b2a60024-e4bd-443c-91b1-1ac69fd8b688", "citation": "Xie, Cong, et al. \"Sulfation and its effect on the bioactivity of magnolol, the main active ingredient of Magnolia officinalis.\" Metabolites 12.9 (2022): 870.", "url": "https://www.mdpi.com/2218-1989/12/9/870", "doc_type": "JA", "public_domain": true }, { "uuid": "68e7d612-3721-26f0-bd7a-734f34d59592", "citation": "JECFA", "doc_type": "JECFA", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "9865f408-6f8f-452e-9ffd-4ffca2a96a8f", "id": "9865f408-6f8f-452e-9ffd-4ffca2a96a8f", "molfile": "\n Marvin 01132107552D \n\n 20 21 0 0 0 0 999 V2000\n 8.0350 -6.5670 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5622 -5.9422 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3725 -6.0935 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.9095 -5.4687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.6409 -4.6877 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.1632 -3.9898 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.7434 -3.1112 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.1632 -2.2911 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.8356 -4.5365 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.2938 -5.1564 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5561 -5.1564 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.2340 -5.8934 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4090 -5.8934 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0526 -6.5182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2961 -6.8354 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1936 -7.6506 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9892 -5.1710 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4090 -4.4584 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.2340 -4.4584 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.6488 -3.7409 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 3 2 1 0 0 0 0\n 2 10 2 0 0 0 0\n 3 4 2 0 0 0 0\n 4 5 1 0 0 0 0\n 6 5 1 0 0 0 0\n 5 9 2 0 0 0 0\n 7 6 1 0 0 0 0\n 8 7 2 0 0 0 0\n 9 10 1 0 0 0 0\n 10 11 1 0 0 0 0\n 12 11 1 0 0 0 0\n 19 11 2 0 0 0 0\n 13 12 2 0 0 0 0\n 14 13 1 0 0 0 0\n 17 13 1 0 0 0 0\n 15 14 1 0 0 0 0\n 16 15 2 0 0 0 0\n 18 17 2 0 0 0 0\n 18 19 1 0 0 0 0\n 20 19 1 0 0 0 0\nM END", "smiles": "C=CCc1ccc(c(c1)-c2cc(CC=C)ccc2O)O", "formula": "C18H18O2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "e7071358-f1e4-48ed-92b2-51f384733721" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "266.335", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "acdc6a6c-fcc9-4ebb-8448-194d6717c2db", "version": "13", "structure": { "id": "f62833ba-aa67-44ef-821d-19aa90654db0", "molfile": "\n Marvin 01132112452D \n\n 20 21 0 0 0 0 999 V2000\n 6.5561 -5.1564 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.2938 -5.1564 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5622 -5.9422 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3725 -6.0935 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.9095 -5.4687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.6409 -4.6877 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.8356 -4.5365 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.1632 -3.9898 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.7434 -3.1112 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.1632 -2.2911 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.0350 -6.5670 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.2340 -4.4584 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4090 -4.4584 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9892 -5.1710 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4090 -5.8934 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.2340 -5.8934 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0526 -6.5182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2961 -6.8354 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1936 -7.6506 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.6488 -3.7409 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 2 1 0 0 0 0\n 4 3 2 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 2 0 0 0 0\n 6 7 1 0 0 0 0\n 7 2 2 0 0 0 0\n 8 6 1 0 0 0 0\n 9 8 1 0 0 0 0\n 10 9 2 0 0 0 0\n 11 3 1 0 0 0 0\n 12 1 1 0 0 0 0\n 13 12 2 0 0 0 0\n 13 14 1 0 0 0 0\n 14 15 2 0 0 0 0\n 15 16 1 0 0 0 0\n 16 1 2 0 0 0 0\n 17 15 1 0 0 0 0\n 18 17 1 0 0 0 0\n 19 18 2 0 0 0 0\n 20 12 1 0 0 0 0\nM END", "smiles": "C=CCc1ccc(c(c1)-c2cc(CC=C)ccc2O)O", "formula": "C18H18O2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "266.335", "optical_activity": "NONE", "references": [ "fbb992ed-3751-45b8-bad4-7a32df01ab88", "06275441-9c69-4612-9a8f-fd661c434744" ], "stereo_centers": 0 }, "unii": "001E35HGVF", "relationships": [ { "uuid": "c074811c-6921-433f-bf0f-7c9b722b0eef", "amount": { "uuid": "79f104fe-8afc-4e9a-9f32-b88020a71399" }, "type": "METABOLITE->PARENT", "mediator_substance": { "uuid": "d4ed3f0c-ca65-4e4b-a154-9d60b24668d2", "refuuid": "f2e11720-044c-4aa8-b694-6b98c2a6a656", "name": "Sulfotransferase 1B1", "linking_id": "f2e11720-044c-4aa8-b694-6b98c2a6a656", "ref_pname": "UNSPECIFIED SUBSTANCE", "substance_class": "reference" }, "related_substance": { "uuid": "39a103df-43f2-4321-8986-c393048ad126", "refuuid": "6b84693a-8684-4da0-810f-f6593c039839", "name": "Magnolol sulfate", "unii": "Z748NEY9VL", "linking_id": "Z748NEY9VL", "ref_pname": "Magnolol sulfate", "substance_class": "reference" } }, { "uuid": "20e1a965-f653-42a4-9327-a8741fc0efc5", "amount": { "uuid": "eb47ac96-75f7-4938-ab8e-39c0c3b7bece" }, "type": "PARENT->ACTIVE CONSTITUENT ALWAYS PRESENT", "interaction_type": "MAJOR", "related_substance": { "uuid": "c9ec1cc3-5c38-4379-aa88-63a0dc99aac3", "refuuid": "c0e10260-f30e-4cb4-824f-b433d668fa95", "name": "MAGNOLIA OFFICINALIS BARK", "unii": "5M609NV974", "linking_id": "5M609NV974", "ref_pname": "MAGNOLIA OFFICINALIS BARK", "substance_class": "reference" } } ], "names": [ { "uuid": "b39ecc6b-7b5c-44f3-8b69-cbc752825c9b", "name": "2,2'-BICHAVICOL", "stdName": "2,2'-BICHAVICOL", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "857c9bfd-432e-426d-831c-0481a38b6e53", "f5bbac6d-d9a3-454f-aa17-5a2454bfd324" ], "display_name": false }, { "uuid": "df13654f-898c-4e72-8cd7-2341b815e4b3", "name": "2,2'-DIHYDROXY-5,5'-DIALLYLBIPHENYL", "stdName": "2,2'-DIHYDROXY-5,5'-DIALLYLBIPHENYL", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "857c9bfd-432e-426d-831c-0481a38b6e53", "f5bbac6d-d9a3-454f-aa17-5a2454bfd324" ], "display_name": false }, { "uuid": "85cd41e6-999d-466e-841f-d27eac083c8a", "name": "5,5'-DI-2-PROPEN-1-YL-(1,1'-BIPHENYL)-2,2'-DIOL", "stdName": "5,5'-DI-2-PROPEN-1-YL-(1,1'-BIPHENYL)-2,2'-DIOL", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "857c9bfd-432e-426d-831c-0481a38b6e53", "f5bbac6d-d9a3-454f-aa17-5a2454bfd324" ], "display_name": false }, { "uuid": "56431833-eb1d-4823-aebd-f1f866f6e901", "name": "5,5'-DIALLYL-2,2'-BIPHENYLDIOL", "stdName": "5,5'-DIALLYL-2,2'-BIPHENYLDIOL", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "857c9bfd-432e-426d-831c-0481a38b6e53", "f5bbac6d-d9a3-454f-aa17-5a2454bfd324" ], "display_name": false }, { "uuid": "55e378bd-4072-43aa-9671-a370c48f04f4", "name": "DEHYDRODICHAVICOL", "stdName": "DEHYDRODICHAVICOL", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "857c9bfd-432e-426d-831c-0481a38b6e53", "f5bbac6d-d9a3-454f-aa17-5a2454bfd324" ], "display_name": false }, { "uuid": "7490027d-a09a-4e83-a34c-ae208f27a061", "name": "FEMA NO. 4559", "stdName": "FEMA NO. 4559", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "857c9bfd-432e-426d-831c-0481a38b6e53", "1e8afcd7-6a9d-43a8-998f-4a438a59db8e" ], "display_name": false }, { "uuid": "8a5302a6-73bd-4196-a652-5bc7fe1d284f", "name": "MAGNOLOL", "stdName": "MAGNOLOL", "type": "of", "languages": [ "en" ], "preferred": false, "references": [ "1a014d43-fea6-44ca-8213-d9b058bcb747", "fe6a4979-9249-4695-a4e1-be5257db1c18", "857c9bfd-432e-426d-831c-0481a38b6e53", "f2c3e1b6-e282-40f3-b174-f655b6f60a32", "6744fee6-5bfb-403a-9955-d722d2ae1b91", "a2357d93-5f17-4a16-8e8c-f565e11a3bca", "c087c479-1b28-489a-99f1-6a70bf8b9427", "8834fd21-758b-4d36-a0c8-7e65f2084f4d" ], "display_name": true, "domains": [ "cosmetic" ], "name_orgs": [ { "uuid": "38bd5295-a52d-4a35-aedb-2ed7c3c5c34b", "name_org": "INCI" } ] }, { "uuid": "82564646-5d14-480b-870d-f3c35811d9be", "name": "MAGNOLOL [HSDB]", "stdName": "MAGNOLOL [HSDB]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "fe6a4979-9249-4695-a4e1-be5257db1c18", "857c9bfd-432e-426d-831c-0481a38b6e53" ], "display_name": false }, { "uuid": "a41a9b27-a4a9-44c7-9936-1191d8ae5ea6", "name": "MAGNOLOL [MI]", "stdName": "MAGNOLOL [MI]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "857c9bfd-432e-426d-831c-0481a38b6e53", "a2357d93-5f17-4a16-8e8c-f565e11a3bca" ], "display_name": false }, { "uuid": "c875b1a5-204b-4ecf-a7b5-44ea40bbd6a7", "name": "NSC-293099", "stdName": "NSC-293099", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "857c9bfd-432e-426d-831c-0481a38b6e53", "e736fe82-c3d8-415f-ac98-1e6d8ebc7989" ], "display_name": false } ], "properties": [ { "uuid": "a64d1738-d98a-4f4d-93ca-5bcf917f9523", "name": "ORAL BIOAVAILABILITY", "value": { "uuid": "f39a7a55-60b0-4f1c-9b4b-ff54f8686175", "type": "MOLE PERCENT OF AMOUNT ADMINISTERED", "average": 4.9, "units": "%" }, "defining": false, "parameters": [ { "uuid": "bac64fc5-e060-47b3-8351-a307f46091f7", "name": "SPECIES", "type": "BIOLOGICAL", "value": { "uuid": "42864f0f-22d8-443c-a596-86715eefd4e9", "references": [], "non_numeric_value": "RAT" }, "references": [] } ], "property_type": "PHARMACOKINETIC", "references": [ "b2a60024-e4bd-443c-91b1-1ac69fd8b688" ] } ] } ] }