{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "ee2b8159-f550-4f2a-a646-c4644be532c6", "code": "155613-91-5", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=155613-91-5", "code_system": "CAS", "references": [ "23102164-df25-42f0-83ec-de561b5453ab", "0ecf20b8-06eb-4772-9962-4b1e7bc37713" ] }, { "uuid": "0ba389f6-4772-49a1-b367-34f215e8e8bc", "code": "53660660", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/53660660", "code_system": "PUBCHEM", "references": [ "23102164-df25-42f0-83ec-de561b5453ab" ] }, { "uuid": "813d2a11-1bdf-46ff-9e4d-e7ac6550f535", "code": "000BPI4XCV", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "5100611d-decd-002a-f187-2837f502e0db", "code": "DTXSID40904619", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID40904619", "code_system": "EPA CompTox" } ], "substance_class": "chemical", "names": [ { "uuid": "3ff8f6c9-0857-4fde-aa5e-a99355312e49", "name": "DIHEPTYLUNDECYL ADIPATE", "stdName": "DIHEPTYLUNDECYL ADIPATE", "type": "of", "languages": [ "en" ], "preferred": false, "references": [ "408f0e38-08d4-486f-a2f8-d55917e6ebaa", "30d23ce0-4baf-4a4a-a16a-4de6378d6b41", "ba5d0b6e-4ed2-4060-b3d0-718d84c535a5" ], "display_name": true, "domains": [ "cosmetic" ], "name_orgs": [ { "uuid": "1d2b6ebe-03ef-406f-a8ea-4afdbf958ae5", "name_org": "INCI" } ] }, { "uuid": "11b4cfe5-3782-46cb-8b08-5f5d175b1ca0", "name": "HEXANEDIOIC ACID, 1,6-BIS(2-HEPTYLUNDECYL) ESTER", "stdName": "HEXANEDIOIC ACID, 1,6-BIS(2-HEPTYLUNDECYL) ESTER", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "001f9a34-ae57-4383-93bd-cf2cad643909", "ba5d0b6e-4ed2-4060-b3d0-718d84c535a5" ], "display_name": false }, { "uuid": "52f09f1c-cc40-418d-a6c5-de11e85d5d3c", "name": "HEXANEDIOIC ACID, BIS(2-HEPTYLUNDECYL) ESTER", "stdName": "HEXANEDIOIC ACID, BIS(2-HEPTYLUNDECYL) ESTER", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "001f9a34-ae57-4383-93bd-cf2cad643909", "ba5d0b6e-4ed2-4060-b3d0-718d84c535a5" ], "display_name": false }, { "uuid": "9f90e196-6aef-4f35-8256-a53ada302151", "name": "NS-218", "stdName": "NS-218", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "30d23ce0-4baf-4a4a-a16a-4de6378d6b41", "ba5d0b6e-4ed2-4060-b3d0-718d84c535a5" ], "display_name": false } ], "references": [ { "uuid": "30d23ce0-4baf-4a4a-a16a-4de6378d6b41", "citation": "PCPC", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "ba5d0b6e-4ed2-4060-b3d0-718d84c535a5", "citation": "PERSONAL CARE PRODUCTS COUNCIL", "doc_type": "PERSONAL CARE PRODUCTS COUNCIL", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "001f9a34-ae57-4383-93bd-cf2cad643909", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "23102164-df25-42f0-83ec-de561b5453ab", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493391493000, "tags": [ "NOMEN" ] }, { "uuid": "31ad13af-88a1-4939-8e98-d8e12a330286", "citation": "SRS import [000BPI4XCV]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=000BPI4XCV", "doc_type": "SRS", "public_domain": true, "document_date": 1493391493000, "tags": [ "NOMEN" ] }, { "uuid": "408f0e38-08d4-486f-a2f8-d55917e6ebaa", "citation": "DIHEPTYLUNDECYL ADIPATE [INCI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "0ecf20b8-06eb-4772-9962-4b1e7bc37713", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "916bf2d6-2ba4-4afb-b9d4-4f0b7af0fa13", "id": "916bf2d6-2ba4-4afb-b9d4-4f0b7af0fa13", "molfile": "\n Marvin 01132107322D \n\n 46 45 0 0 0 0 999 V2000\n 3.3568 -9.7649 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.0713 -9.3524 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.0713 -8.5274 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.7858 -8.1149 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.7858 -7.2899 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5002 -6.8774 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5002 -6.0524 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.2147 -5.6399 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.2147 -4.8149 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.9292 -4.4024 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 6.9292 -3.5774 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.2147 -3.1649 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.2147 -2.3399 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5002 -1.9274 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5002 -1.1024 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.7858 -0.6899 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.7858 0.1351 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.6436 -4.8149 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.6436 -5.6399 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.3581 -6.0524 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.0726 -5.6399 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.3581 -6.8774 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.0726 -7.2899 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.0726 -8.1149 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.7871 -8.5274 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.7871 -9.3524 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.0726 -9.7649 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.5015 -9.7649 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.5015 -10.5899 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.2160 -11.0024 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 11.2160 -11.8274 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.9305 -12.2399 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.9305 -13.0649 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.6450 -13.4774 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.6450 -14.3024 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.3594 -14.7149 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.3594 -15.5399 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.9305 -10.5899 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.9305 -9.7649 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.6450 -9.3524 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.6450 -8.5274 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.3594 -8.1149 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.3594 -7.2899 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.0739 -6.8774 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.0739 -6.0524 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.7884 -5.6399 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 2 1 0 0 0 0\n 4 3 1 0 0 0 0\n 5 4 1 0 0 0 0\n 6 5 1 0 0 0 0\n 7 6 1 0 0 0 0\n 8 7 1 0 0 0 0\n 9 8 1 0 0 0 0\n 10 9 1 0 0 0 0\n 11 10 1 0 0 0 0\n 10 18 1 0 0 0 0\n 12 11 1 0 0 0 0\n 13 12 1 0 0 0 0\n 14 13 1 0 0 0 0\n 15 14 1 0 0 0 0\n 15 16 1 0 0 0 0\n 16 17 1 0 0 0 0\n 18 19 1 0 0 0 0\n 19 20 1 0 0 0 0\n 20 21 2 0 0 0 0\n 20 22 1 0 0 0 0\n 22 23 1 0 0 0 0\n 23 24 1 0 0 0 0\n 24 25 1 0 0 0 0\n 25 26 1 0 0 0 0\n 26 27 2 0 0 0 0\n 26 28 1 0 0 0 0\n 28 29 1 0 0 0 0\n 29 30 1 0 0 0 0\n 30 31 1 0 0 0 0\n 30 38 1 0 0 0 0\n 31 32 1 0 0 0 0\n 32 33 1 0 0 0 0\n 33 34 1 0 0 0 0\n 34 35 1 0 0 0 0\n 35 36 1 0 0 0 0\n 36 37 1 0 0 0 0\n 38 39 1 0 0 0 0\n 39 40 1 0 0 0 0\n 40 41 1 0 0 0 0\n 41 42 1 0 0 0 0\n 42 43 1 0 0 0 0\n 43 44 1 0 0 0 0\n 44 45 1 0 0 0 0\n 45 46 1 0 0 0 0\nM END", "smiles": "CCCCCCCCCC(CCCCCCC)COC(=O)CCCCC(=O)OCC(CCCCCCC)CCCCCCCCC", "formula": "C42H82O4", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "MIXED", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "8a97a8c2-0846-4142-b382-974481fdd8fb" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "651.0997", "optical_activity": "UNSPECIFIED", "stereo_centers": 2 } ], "definition_level": "COMPLETE", "uuid": "9ab929af-d058-480c-a57e-a56829814a2a", "version": "4", "structure": { "id": "d43e1ba3-f99f-4959-8e30-16e128c88617", "molfile": "\n Marvin 01132111002D \n\n 46 45 0 0 0 0 999 V2000\n 9.7871 -8.5274 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.0726 -8.1149 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.0726 -7.2899 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.3581 -6.8774 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.3581 -6.0524 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.6436 -5.6399 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.6436 -4.8149 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.9292 -4.4024 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.9292 -3.5774 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.2147 -3.1649 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.2147 -2.3399 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5002 -1.9274 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5002 -1.1024 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.0726 -5.6399 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.7871 -9.3524 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.0726 -9.7649 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.5015 -9.7649 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.5015 -10.5899 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.2160 -11.0024 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.2160 -11.8274 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.9305 -12.2399 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.9305 -13.0649 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.6450 -13.4774 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.6450 -14.3024 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.3594 -14.7149 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.3594 -15.5399 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.7858 -0.6899 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.7858 0.1351 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.2147 -4.8149 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.2147 -5.6399 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5002 -6.0524 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5002 -6.8774 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.7858 -7.2899 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.7858 -8.1149 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.0713 -8.5274 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.0713 -9.3524 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.3568 -9.7649 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.9305 -10.5899 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.9305 -9.7649 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.6450 -9.3524 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.6450 -8.5274 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.3594 -8.1149 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.3594 -7.2899 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.0739 -6.8774 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.0739 -6.0524 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.7884 -5.6399 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 2 1 0 0 0 0\n 4 3 1 0 0 0 0\n 5 4 1 0 0 0 0\n 6 5 1 0 0 0 0\n 7 6 1 0 0 0 0\n 8 7 1 0 0 0 0\n 9 8 1 0 0 0 0\n 10 9 1 0 0 0 0\n 11 10 1 0 0 0 0\n 12 11 1 0 0 0 0\n 13 12 1 0 0 0 0\n 5 14 2 0 0 0 0\n 1 15 1 0 0 0 0\n 15 16 2 0 0 0 0\n 15 17 1 0 0 0 0\n 17 18 1 0 0 0 0\n 18 19 1 0 0 0 0\n 19 20 1 0 0 0 0\n 20 21 1 0 0 0 0\n 21 22 1 0 0 0 0\n 22 23 1 0 0 0 0\n 23 24 1 0 0 0 0\n 24 25 1 0 0 0 0\n 25 26 1 0 0 0 0\n 13 27 1 0 0 0 0\n 27 28 1 0 0 0 0\n 8 29 1 0 0 0 0\n 29 30 1 0 0 0 0\n 30 31 1 0 0 0 0\n 31 32 1 0 0 0 0\n 32 33 1 0 0 0 0\n 33 34 1 0 0 0 0\n 34 35 1 0 0 0 0\n 35 36 1 0 0 0 0\n 36 37 1 0 0 0 0\n 19 38 1 0 0 0 0\n 38 39 1 0 0 0 0\n 39 40 1 0 0 0 0\n 40 41 1 0 0 0 0\n 41 42 1 0 0 0 0\n 42 43 1 0 0 0 0\n 43 44 1 0 0 0 0\n 44 45 1 0 0 0 0\n 45 46 1 0 0 0 0\nM END", "smiles": "CCCCCCCCCC(CCCCCCC)COC(=O)CCCCC(=O)OCC(CCCCCCC)CCCCCCCCC", "formula": "C42H82O4", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "MIXED", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "651.0997", "optical_activity": "UNSPECIFIED", "references": [ "31ad13af-88a1-4939-8e98-d8e12a330286", "001f9a34-ae57-4383-93bd-cf2cad643909" ], "stereo_centers": 2 }, "unii": "000BPI4XCV" } ] }