{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 2
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "10c48d42-a15a-4cf2-819d-add22b133721",
          "code": "94729-48-3",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=94729-48-3",
          "code_system": "CAS",
          "references": [
            "3d68a31a-8ecd-4182-b414-552fc3d47523",
            "42b37f52-57ae-49e8-bf58-2abc22971e75"
          ]
        },
        {
          "uuid": "d3258991-5ea5-46a0-a4e8-316cda39a1e3",
          "code": "SUB25762",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "3d68a31a-8ecd-4182-b414-552fc3d47523"
          ]
        },
        {
          "uuid": "175563a5-feab-4ec6-a246-b3c129c4dfde",
          "code": "71587354",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/71587354",
          "code_system": "PUBCHEM",
          "references": [
            "3d68a31a-8ecd-4182-b414-552fc3d47523"
          ]
        },
        {
          "uuid": "044e2aad-baed-d12c-f4d3-42d6e9e14c77",
          "code": "DTXSID30241585",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID30241585",
          "code_system": "EPA CompTox",
          "references": [
            "1522884e-db56-c37b-f42b-e607107a1147"
          ]
        },
        {
          "uuid": "8ca706c4-a849-454f-8256-e831389281a3",
          "code": "832IRM2G6W",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "d3f2d95a-91ce-990b-b622-7769e6e15142",
          "code": "100000089891",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "20e253e2-f500-61ba-dcab-ee0ff649cc0a"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "a0d31165-9ebc-49cf-b521-ade4cebf8c11",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "edd12c46-c242-44f9-ab08-5e66b49294fa",
            "refuuid": "3c3d5468-4e34-4e1d-ac8a-60aaae105055",
            "name": "LYSYLGLUTAMIC ACID",
            "unii": "H34V7IM5ML",
            "linking_id": "H34V7IM5ML",
            "ref_pname": "LYSYLGLUTAMIC ACID",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "1cefa15a-611b-411f-8875-44e39dea83b8",
          "type": "PARENT->SALT/SOLVATE",
          "related_substance": {
            "uuid": "a1830749-d282-4d3f-b481-fd4d0b3107c3",
            "refuuid": "3c3d5468-4e34-4e1d-ac8a-60aaae105055",
            "name": "LYSYLGLUTAMIC ACID",
            "unii": "H34V7IM5ML",
            "linking_id": "H34V7IM5ML",
            "ref_pname": "LYSYLGLUTAMIC ACID",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "03aeda96-289d-7f50-81bc-31ff11169824",
          "type": "ANHYDROUS->SOLVATE",
          "references": [
            "42b37f52-57ae-49e8-bf58-2abc22971e75"
          ],
          "related_substance": {
            "uuid": "abdaae14-58e9-43ba-b570-9457a6d54be0",
            "refuuid": "3c3d5468-4e34-4e1d-ac8a-60aaae105055",
            "name": "LYSYLGLUTAMIC ACID",
            "unii": "H34V7IM5ML",
            "linking_id": "H34V7IM5ML",
            "ref_pname": "LYSYLGLUTAMIC ACID"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "f7910861-67d6-45cf-8269-47c9caabaee2",
          "name": "L-LYSINE L-GLUTAMATE DIHYDRATE",
          "stdName": "L-LYSINE L-GLUTAMATE DIHYDRATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "71387871-3f0f-4a74-8072-b046b783fd46",
            "ba6511fb-1756-4caf-a273-99a56e5639cd"
          ],
          "display_name": false
        },
        {
          "uuid": "1895a843-5639-4810-ab13-2189d2bc3793",
          "name": "LYS-GLU DIHYDRATE",
          "stdName": "LYS-GLU DIHYDRATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "467efe1b-2561-430f-a89a-71c058b54268",
            "ba6511fb-1756-4caf-a273-99a56e5639cd"
          ],
          "display_name": false
        },
        {
          "uuid": "3c6e9831-5b3c-4988-a6ca-ce0e32cbc450",
          "name": "LYSINE GLUTAMATE DIHYDRATE",
          "stdName": "LYSINE GLUTAMATE DIHYDRATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "71387871-3f0f-4a74-8072-b046b783fd46",
            "ba6511fb-1756-4caf-a273-99a56e5639cd"
          ],
          "display_name": false
        },
        {
          "uuid": "b349e325-540a-49bc-a55d-e61d0bf0baf6",
          "name": "LYSYLGLUTAMIC ACID DIHYDRATE",
          "stdName": "LYSYLGLUTAMIC ACID DIHYDRATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ac70e013-761e-4452-9cf5-6dd921230128",
            "ba6511fb-1756-4caf-a273-99a56e5639cd"
          ],
          "display_name": true
        },
        {
          "uuid": "b8d8ceb7-3b5c-4571-b025-274804d84688",
          "name": "Lysine glutamate dihydrate [WHO-DD]",
          "stdName": "LYSINE GLUTAMATE DIHYDRATE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a984b316-1f03-35ea-8c4b-16e01920208d"
          ],
          "display_name": false
        },
        {
          "uuid": "9fde3dd4-1cde-4987-b94e-d3386c045835",
          "name": "VILON DIHYDRATE",
          "stdName": "VILON DIHYDRATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "467efe1b-2561-430f-a89a-71c058b54268",
            "ba6511fb-1756-4caf-a273-99a56e5639cd"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "ac70e013-761e-4452-9cf5-6dd921230128",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "ba6511fb-1756-4caf-a273-99a56e5639cd",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "467efe1b-2561-430f-a89a-71c058b54268",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "71387871-3f0f-4a74-8072-b046b783fd46",
          "citation": "SWEDISH LIST",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3d68a31a-8ecd-4182-b414-552fc3d47523",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391929000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a2e4c8a9-7135-49e2-ae6b-71b806c7f684",
          "citation": "SRS import [832IRM2G6W]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=832IRM2G6W",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391929000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1522884e-db56-c37b-f42b-e607107a1147",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=94729-48-3",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "a984b316-1f03-35ea-8c4b-16e01920208d",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "42b37f52-57ae-49e8-bf58-2abc22971e75",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "20e253e2-f500-61ba-dcab-ee0ff649cc0a",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "b309340b-16d7-4de5-b3ea-2a1772dc7faa",
          "id": "b309340b-16d7-4de5-b3ea-2a1772dc7faa",
          "molfile": "\n  Marvin  01132109162D          \n\n  1  0  0  0  1  0            999 V2000\n   -0.0689   -6.4743    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\nM  END",
          "smiles": "O",
          "formula": "H2O",
          "atropisomerism": "No",
          "charge": 0,
          "count": 2,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 2,
            "units": "MOL RATIO",
            "uuid": "907403bf-9bda-48ee-bb4c-42f8aab4bf2c"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "18.0153",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "0f803688-d771-4579-9e1d-1dc50154de09",
          "id": "0f803688-d771-4579-9e1d-1dc50154de09",
          "molfile": "\n  Marvin  01132101022D          \n\n 19 18  0  0  1  0            999 V2000\n    6.0250   -3.1990    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    6.0250   -2.3704    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2891   -3.5737    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5924   -3.1246    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8611   -3.5039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1722   -3.0548    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4341   -3.4342    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7172   -3.6436    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7172   -4.4675    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4530   -3.2688    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0555   -3.8262    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    8.8437   -3.5827    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0294   -2.7817    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8177   -2.5383    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4248   -3.0957    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0035   -1.7281    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8743   -4.6319    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4813   -5.1940    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0861   -4.8800    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  6  0  0  0\n  1  3  1  0  0  0  0\n  1  8  1  0  0  0  0\n  4  3  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  8  9  2  0  0  0  0\n  8 10  1  0  0  0  0\n 11 10  1  1  0  0  0\n 11 12  1  0  0  0  0\n 11 17  1  0  0  0  0\n 13 12  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 14 16  2  0  0  0  0\n 17 18  1  0  0  0  0\n 17 19  2  0  0  0  0\nM  END",
          "smiles": "C(CCN)C[C@@H](C(=O)N[C@@H](CCC(=O)O)C(=O)O)N",
          "formula": "C11H21N3O5",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "1de479ea-2d3b-4d41-877a-1649dfd78a2c"
          },
          "defined_stereo": 2,
          "ez_centers": 0,
          "molecular_weight": "275.302",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 2
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "1327ff13-e274-41aa-a2b5-f807d14acb50",
      "version": "8",
      "structure": {
        "id": "28501972-d550-40ce-947b-da072566ba80",
        "molfile": "\n  Marvin  01132102122D          \n\n 21 18  0  0  1  0            999 V2000\n    6.0250   -2.3704    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0250   -3.1990    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    6.7172   -3.6436    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7172   -4.4675    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4530   -3.2688    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0555   -3.8262    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    8.8437   -3.5827    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0294   -2.7817    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8177   -2.5383    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4248   -3.0957    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0035   -1.7281    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8743   -4.6319    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4813   -5.1940    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0861   -4.8800    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2891   -3.5737    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5924   -3.1246    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8611   -3.5039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1722   -3.0548    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4341   -3.4342    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.0689   -6.4743    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.0689   -6.4743    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  2  0  0  0  0\n  3  5  1  0  0  0  0\n  6  5  1  0  0  0  0\n  6  7  1  1  0  0  0\n  8  7  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n  9 11  2  0  0  0  0\n  6 12  1  0  0  0  0\n 12 13  2  0  0  0  0\n 12 14  1  0  0  0  0\n  2 15  1  6  0  0  0\n 16 15  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n  2  1  1  0  0  0  0\nM  STY  1   1 MUL\nM  SCN  1   1 HT \nM  SAL   1  2  20  21\nM  SPA   1  1  20\nM  SDI   1  4   -0.4889   -6.8943   -0.4889   -6.0543\nM  SDI   1  4    0.3511   -6.0543    0.3511   -6.8943\nM  SMT   1 2\nM  END",
        "smiles": "C(CCN)C[C@@H](C(=O)N[C@@H](CCC(=O)O)C(=O)O)N.O.O",
        "formula": "C11H21N3O5.2H2O",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 2,
        "ez_centers": 0,
        "molecular_weight": "311.3326",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "ac70e013-761e-4452-9cf5-6dd921230128",
          "a2e4c8a9-7135-49e2-ae6b-71b806c7f684"
        ],
        "stereo_centers": 2
      },
      "unii": "832IRM2G6W"
    }
  ]
}